Compound Q&A

What are the physical and chemical properties of 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4)?

Answer

4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid
4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 329.21 g/mol. It is slightly soluble in water and more soluble in organic solvents like methanol and ethanol. This compound exhibits typical reactivity of carboxylic acids and can undergo typical reactions such as esterification and amidation. It is also known for its stability under normal conditions but can decompose at high temperatures.

About

CAS No 60547-92-4
English Name 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid
Molecular Formula C15H13NO6
Molecular Weight 303.27 g/mol
SMILES COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OCC2=CC=CC=C2
InChIKey VTHHRADLOLKTLD-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4) typically synthesized?

4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid is typically synthesized via the nitration of 4-(benzylo...

Compound Q&A

What industries use 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4)?

4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid (CAS: 60547-92-4)?

When handling 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid, it is crucial to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...