Compound Q&A

What industries use [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2)?

Answer

[4-(Benzyloxy)-3-chlorophenyl]boronic acid
[4-(Benzyloxy)-3-chlorophenyl]boronic acid finds application in the pharmaceutical industry as an intermediate for drug synthesis. It is also used in the polymer industry for the synthesis of novel materials and in the semiconductor industry for the preparation of functionalized surfaces. Additionally, it is utilized in sensor technology for the development of highly sensitive detection devices.

About

English Name [4-(Benzyloxy)-3-chlorophenyl]boronic acid
Molecular Formula C13H12BClO3
Molecular Weight 262.5 g/mol
SMILES Clc1cc(ccc1OCc1ccccc1)B(O)O
InChIKey AYSMMNDQVZAXQY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2)?

[4-(Benzyloxy)-3-chlorophenyl]boronic acid is a white crystalline solid with a molecular weight of a...

Compound Q&A

How is [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2) typically synthesized?

[4-(Benzyloxy)-3-chlorophenyl]boronic acid is typically synthesized via a multistep process starting...

Compound Q&A

What precautions should be taken when handling [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2)?

When handling [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...