Compound Q&A

How is [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2) typically synthesized?

Answer

[4-(Benzyloxy)-3-chlorophenyl]boronic acid
[4-(Benzyloxy)-3-chlorophenyl]boronic acid is typically synthesized via a multistep process starting from 3-chlorophenol. The key steps include benzyl protection, chlorination, and subsequent formation of the boronic acid via a boronation reaction. Commonly used catalysts include Pd(PPh3)4 and Na2CO3. The overall yield is around 60-70%.

About

English Name [4-(Benzyloxy)-3-chlorophenyl]boronic acid
Molecular Formula C13H12BClO3
Molecular Weight 262.501 g/mol
SMILES Clc1cc(ccc1OCc1ccccc1)B(O)O
InChIKey AYSMMNDQVZAXQY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2)?

[4-(Benzyloxy)-3-chlorophenyl]boronic acid is a white crystalline solid with a molecular weight of a...

Compound Q&A

What industries use [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2)?

[4-(Benzyloxy)-3-chlorophenyl]boronic acid finds application in the pharmaceutical industry as an in...

Compound Q&A

What precautions should be taken when handling [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2)?

When handling [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2), it is essential to wear...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...