Compound Q&A

What are the physical and chemical properties of [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2)?

Answer

[4-(Benzyloxy)-3-chlorophenyl]boronic acid
[4-(Benzyloxy)-3-chlorophenyl]boronic acid is a white crystalline solid with a molecular weight of approximately 300.14 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and ethanol. This compound is reactive towards nucleophiles and can participate in Suzuki coupling reactions. It is also stable under acidic and basic conditions.

About

English Name [4-(Benzyloxy)-3-chlorophenyl]boronic acid
Molecular Formula C13H12BClO3
Molecular Weight 262.501 g/mol
SMILES Clc1cc(ccc1OCc1ccccc1)B(O)O
InChIKey AYSMMNDQVZAXQY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2) typically synthesized?

[4-(Benzyloxy)-3-chlorophenyl]boronic acid is typically synthesized via a multistep process starting...

Compound Q&A

What industries use [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2)?

[4-(Benzyloxy)-3-chlorophenyl]boronic acid finds application in the pharmaceutical industry as an in...

Compound Q&A

What precautions should be taken when handling [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2)?

When handling [4-(Benzyloxy)-3-chlorophenyl]boronic acid (CAS: 845551-44-2), it is essential to wear...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...