Compound Q&A

What industries use 3,5-Dibromotyrosine (CAS: 300-38-9)?

Answer

3,5-Dibromotyrosine
3,5-Dibromotyrosine (CAS: 300-38-9) is used in the pharmaceutical industry for the synthesis of certain drugs and intermediates. It is also utilized in the development of sensors and in the production of novel materials for semiconductors and polymers. The compound's unique structure makes it useful in various applications where bromine functionality is required.

About

CAS No 300-38-9
English Name 3,5-Dibromotyrosine
Molecular Formula C9H9Br2NO3
Molecular Weight 338.98 g/mol
SMILES OC(=O)[C@H](Cc1cc(Br)c(c(c1)Br)O)N
InChIKey COESHZUDRKCEPA-ZETCQYMHSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dibromotyrosine (CAS: 300-38-9)?

3,5-Dibromotyrosine (CAS: 300-38-9) is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is 3,5-Dibromotyrosine (CAS: 300-38-9) typically synthesized?

3,5-Dibromotyrosine (CAS: 300-38-9) is typically synthesized through bromination of tyrosine using b...

Compound Q&A

What precautions should be taken when handling 3,5-Dibromotyrosine (CAS: 300-38-9)?

When handling 3,5-Dibromotyrosine (CAS: 300-38-9), it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...