Compound Q&A

What are the physical and chemical properties of 3,5-Dibromotyrosine (CAS: 300-38-9)?

Answer

3,5-Dibromotyrosine
3,5-Dibromotyrosine (CAS: 300-38-9) is a crystalline solid with a molecular weight of approximately 287.07 g/mol. It has a low solubility in water and is more soluble in organic solvents. This compound is relatively stable but can react with reducing agents. It has a melting point of around 235-238°C and is slightly acidic due to its carboxyl group.

About

CAS No 300-38-9
English Name 3,5-Dibromotyrosine
Molecular Formula C9H9Br2NO3
Molecular Weight 338.98 g/mol
SMILES OC(=O)[C@H](Cc1cc(Br)c(c(c1)Br)O)N
InChIKey COESHZUDRKCEPA-ZETCQYMHSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 3,5-Dibromotyrosine (CAS: 300-38-9) typically synthesized?

3,5-Dibromotyrosine (CAS: 300-38-9) is typically synthesized through bromination of tyrosine using b...

Compound Q&A

What industries use 3,5-Dibromotyrosine (CAS: 300-38-9)?

3,5-Dibromotyrosine (CAS: 300-38-9) is used in the pharmaceutical industry for the synthesis of cert...

Compound Q&A

What precautions should be taken when handling 3,5-Dibromotyrosine (CAS: 300-38-9)?

When handling 3,5-Dibromotyrosine (CAS: 300-38-9), it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...