Compound Q&A

How is 3,5-Dibromotyrosine (CAS: 300-38-9) typically synthesized?

Answer

3,5-Dibromotyrosine
3,5-Dibromotyrosine (CAS: 300-38-9) is typically synthesized through bromination of tyrosine using bromine in the presence of a base like sodium hydroxide. The reaction is carried out in an aprotic solvent such as dimethylformamide (DMF). The yield and selectivity of the reaction can be enhanced by using appropriate catalysts and optimizing reaction conditions.

About

CAS No 300-38-9
English Name 3,5-Dibromotyrosine
Molecular Formula C9H9Br2NO3
Molecular Weight 338.98 g/mol
SMILES OC(=O)[C@H](Cc1cc(Br)c(c(c1)Br)O)N
InChIKey COESHZUDRKCEPA-ZETCQYMHSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dibromotyrosine (CAS: 300-38-9)?

3,5-Dibromotyrosine (CAS: 300-38-9) is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use 3,5-Dibromotyrosine (CAS: 300-38-9)?

3,5-Dibromotyrosine (CAS: 300-38-9) is used in the pharmaceutical industry for the synthesis of cert...

Compound Q&A

What precautions should be taken when handling 3,5-Dibromotyrosine (CAS: 300-38-9)?

When handling 3,5-Dibromotyrosine (CAS: 300-38-9), it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...