Compound Q&A

What industries use Ethyl 4,6-dichloro-2-methylnicotinate (CAS: 686279-09-4)?

Answer

Ethyl 4,6-dichloro-2-methylnicotinate
Ethyl 4,6-dichloro-2-methylnicotinate is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It can also be found in the polymer industry for the modification of polymer properties and in the chemical sensing sector for developing gas sensors. Its use in semiconductors is less common but it can be utilized in specific applications.

About

English Name Ethyl 4,6-dichloro-2-methylnicotinate
Molecular Formula C9H9Cl2NO2
Molecular Weight 234.08 g/mol
SMILES CCOC(=O)C1=C(N=C(C=C1Cl)Cl)C
InChIKey LNIMLSAAPISOEC-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4,6-dichloro-2-methylnicotinate (CAS: 686279-09-4)?

Ethyl 4,6-dichloro-2-methylnicotinate is a crystalline compound with a molecular weight of approxima...

Compound Q&A

How is Ethyl 4,6-dichloro-2-methylnicotinate (CAS: 686279-09-4) typically synthesized?

Ethyl 4,6-dichloro-2-methylnicotinate is typically synthesized via the condensation of 4,6-dichloro-...

Compound Q&A

What precautions should be taken when handling Ethyl 4,6-dichloro-2-methylnicotinate (CAS: 686279-09-4)?

Handling Ethyl 4,6-dichloro-2-methylnicotinate should be done with caution. It is recommended to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...