Compound Q&A

How is Ethyl 4,6-dichloro-2-methylnicotinate (CAS: 686279-09-4) typically synthesized?

Answer

Ethyl 4,6-dichloro-2-methylnicotinate
Ethyl 4,6-dichloro-2-methylnicotinate is typically synthesized via the condensation of 4,6-dichloro-2-methylpyridine with acetyl chloride in the presence of anhydrous aluminum chloride as a catalyst. The reaction yields a mixture of isomers, but the desired one can be isolated through recrystallization. The reaction is exothermic and requires careful temperature control.

About

English Name Ethyl 4,6-dichloro-2-methylnicotinate
Molecular Formula C9H9Cl2NO2
Molecular Weight 234.08 g/mol
SMILES CCOC(=O)C1=C(N=C(C=C1Cl)Cl)C
InChIKey LNIMLSAAPISOEC-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4,6-dichloro-2-methylnicotinate (CAS: 686279-09-4)?

Ethyl 4,6-dichloro-2-methylnicotinate is a crystalline compound with a molecular weight of approxima...

Compound Q&A

What industries use Ethyl 4,6-dichloro-2-methylnicotinate (CAS: 686279-09-4)?

Ethyl 4,6-dichloro-2-methylnicotinate is primarily used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling Ethyl 4,6-dichloro-2-methylnicotinate (CAS: 686279-09-4)?

Handling Ethyl 4,6-dichloro-2-methylnicotinate should be done with caution. It is recommended to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...