Compound Q&A

What precautions should be taken when handling Zebularine (CAS: 3690-10-6)?

Answer

Zebularine
When handling Zebularine, ensure proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood. Store it at room temperature away from direct sunlight and heat sources. In case of spill, use appropriate cleanup materials and follow standard laboratory procedures. Refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

CAS No 3690-10-6
English Name Zebularine
Molecular Formula C9H12N2O5
Molecular Weight 228.2 g/mol
SMILES C1=CN(C(=O)N=C1)C2C(C(C(O2)CO)O)O
InChIKey RPQZTTQVRYEKCR-WCTZXXKLSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zebularine (CAS: 3690-10-6)?

Zebularine is a white crystalline powder with a molecular weight of approximately 285.25 g/mol. It i...

Compound Q&A

How is Zebularine (CAS: 3690-10-6) typically synthesized?

Zebularine is typically synthesized through a multistep process involving the condensation of 4'-deo...

Compound Q&A

What industries use Zebularine (CAS: 3690-10-6)?

Zebularine is primarily used in the pharmaceutical industry for its potential as an inhibitor of DNA...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...