Compound Q&A

What are the physical and chemical properties of Zebularine (CAS: 3690-10-6)?

Answer

Zebularine
Zebularine is a white crystalline powder with a molecular weight of approximately 285.25 g/mol. It is poorly soluble in water but soluble in organic solvents such as methanol and ethanol. Chemically, it exhibits mild reactivity, especially under basic conditions. Zebularine is stable under standard storage conditions and requires minimal handling precautions.

About

CAS No 3690-10-6
English Name Zebularine
Molecular Formula C9H12N2O5
Molecular Weight 228.2 g/mol
SMILES C1=CN(C(=O)N=C1)C2C(C(C(O2)CO)O)O
InChIKey RPQZTTQVRYEKCR-WCTZXXKLSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is Zebularine (CAS: 3690-10-6) typically synthesized?

Zebularine is typically synthesized through a multistep process involving the condensation of 4'-deo...

Compound Q&A

What industries use Zebularine (CAS: 3690-10-6)?

Zebularine is primarily used in the pharmaceutical industry for its potential as an inhibitor of DNA...

Compound Q&A

What precautions should be taken when handling Zebularine (CAS: 3690-10-6)?

When handling Zebularine, ensure proper personal protective equipment (PPE) such as gloves, goggles,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...