Compound Q&A

How is Zebularine (CAS: 3690-10-6) typically synthesized?

Answer

Zebularine
Zebularine is typically synthesized through a multistep process involving the condensation of 4'-deoxy-4'-aza-2'-deoxyadenosine with 2'-deoxyadenosine-5'-monophosphate. The synthesis involves the use of common organic solvents and catalysts such as acetic anhydride and sodium hydride, yielding a product with a high degree of selectivity and a yield of around 70-80%.

About

CAS No 3690-10-6
English Name Zebularine
Molecular Formula C9H12N2O5
Molecular Weight 228.2 g/mol
SMILES C1=CN(C(=O)N=C1)C2C(C(C(O2)CO)O)O
InChIKey RPQZTTQVRYEKCR-WCTZXXKLSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zebularine (CAS: 3690-10-6)?

Zebularine is a white crystalline powder with a molecular weight of approximately 285.25 g/mol. It i...

Compound Q&A

What industries use Zebularine (CAS: 3690-10-6)?

Zebularine is primarily used in the pharmaceutical industry for its potential as an inhibitor of DNA...

Compound Q&A

What precautions should be taken when handling Zebularine (CAS: 3690-10-6)?

When handling Zebularine, ensure proper personal protective equipment (PPE) such as gloves, goggles,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...