Compound Q&A

What industries use Hexaphenyldisiloxane (CAS: 1829-40-9)?

Answer

Hexaphenyldisiloxane
Hexaphenyldisiloxane (CAS: 1829-40-9) is used in various industries. It serves as a monomer in the synthesis of novel polymers, is a component in pharmaceuticals for specific applications, and is utilized in the development of sensors and semiconductors due to its unique chemical properties. Its stability and reactivity make it valuable in these sectors.

About

CAS No 1829-40-9
English Name Hexaphenyldisiloxane
Molecular Formula C36H30OSi2
Molecular Weight 534.81 g/mol
SMILES C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)O[Si](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6
InChIKey IVZTVZJLMIHPEY-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hexaphenyldisiloxane (CAS: 1829-40-9)?

Hexaphenyldisiloxane (CAS: 1829-40-9) is a colorless, crystalline solid with a molecular weight of a...

Compound Q&A

How is Hexaphenyldisiloxane (CAS: 1829-40-9) typically synthesized?

Hexaphenyldisiloxane is typically synthesized via the condensation of hexachlorodisiloxane with phen...

Compound Q&A

What precautions should be taken when handling Hexaphenyldisiloxane (CAS: 1829-40-9)?

When handling Hexaphenyldisiloxane (CAS: 1829-40-9), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...