Compound Q&A

What are the physical and chemical properties of Hexaphenyldisiloxane (CAS: 1829-40-9)?

Answer

Hexaphenyldisiloxane
Hexaphenyldisiloxane (CAS: 1829-40-9) is a colorless, crystalline solid with a molecular weight of approximately 506.5 g/mol. It has a high melting point of 145-147°C and is poorly soluble in water but soluble in organic solvents like toluene and dichloromethane. Chemically, it is relatively stable but can react with strong acids and bases. Its main reactivity is through its phenyl groups, making it useful in organic synthesis and polymer chemistry.

About

CAS No 1829-40-9
English Name Hexaphenyldisiloxane
Molecular Formula C36H30OSi2
Molecular Weight 534.81 g/mol
SMILES C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)O[Si](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6
InChIKey IVZTVZJLMIHPEY-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Hexaphenyldisiloxane (CAS: 1829-40-9) typically synthesized?

Hexaphenyldisiloxane is typically synthesized via the condensation of hexachlorodisiloxane with phen...

Compound Q&A

What industries use Hexaphenyldisiloxane (CAS: 1829-40-9)?

Hexaphenyldisiloxane (CAS: 1829-40-9) is used in various industries. It serves as a monomer in the s...

Compound Q&A

What precautions should be taken when handling Hexaphenyldisiloxane (CAS: 1829-40-9)?

When handling Hexaphenyldisiloxane (CAS: 1829-40-9), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...