Compound Q&A

How is Hexaphenyldisiloxane (CAS: 1829-40-9) typically synthesized?

Answer

Hexaphenyldisiloxane
Hexaphenyldisiloxane is typically synthesized via the condensation of hexachlorodisiloxane with phenylboronic acid in the presence of a palladium catalyst, such as Pd(PPh3)4, under controlled conditions. The reaction is optimized for high yield and selectivity, with the catalyst facilitating the bond formation between the silicon and phenyl groups, resulting in the formation of the desired hexaphenyldisiloxane product.

About

CAS No 1829-40-9
English Name Hexaphenyldisiloxane
Molecular Formula C36H30OSi2
Molecular Weight 534.81 g/mol
SMILES C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)O[Si](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6
InChIKey IVZTVZJLMIHPEY-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hexaphenyldisiloxane (CAS: 1829-40-9)?

Hexaphenyldisiloxane (CAS: 1829-40-9) is a colorless, crystalline solid with a molecular weight of a...

Compound Q&A

What industries use Hexaphenyldisiloxane (CAS: 1829-40-9)?

Hexaphenyldisiloxane (CAS: 1829-40-9) is used in various industries. It serves as a monomer in the s...

Compound Q&A

What precautions should be taken when handling Hexaphenyldisiloxane (CAS: 1829-40-9)?

When handling Hexaphenyldisiloxane (CAS: 1829-40-9), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...