Compound Q&A

What are the physical and chemical properties of 2,4,5-Triphenyl-1H-imidazole (CAS: 484-47-9)?

Answer

2,4,5-Triphenyl-1H-imidazole
2,4,5-Triphenyl-1H-imidazole is a crystalline solid with a molecular weight of approximately 357.34 g/mol. It has low water solubility and good solubility in organic solvents like chloroform and acetone. The compound is relatively stable under normal conditions but can react with strong acids and bases. It is used as a precursor in organic synthesis and as a building block in the synthesis of other heterocyclic compounds.

About

CAS No 484-47-9
English Name 2,4,5-Triphenyl-1H-imidazole
Molecular Formula C21H16N2
Molecular Weight 296.37 g/mol
SMILES C1=CC=C(C=C1)C2=C(N=C(N2)C3=CC=CC=C3)C4=CC=CC=C4
InChIKey RNIPJYFZGXJSDD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2,4,5-Triphenyl-1H-imidazole (CAS: 484-47-9) typically synthesized?

2,4,5-Triphenyl-1H-imidazole is usually synthesized via the reaction of aniline derivatives with pht...

Compound Q&A

What industries use 2,4,5-Triphenyl-1H-imidazole (CAS: 484-47-9)?

2,4,5-Triphenyl-1H-imidazole is primarily used in the pharmaceutical industry as a precursor for the...

Compound Q&A

What precautions should be taken when handling 2,4,5-Triphenyl-1H-imidazole (CAS: 484-47-9)?

When handling 2,4,5-Triphenyl-1H-imidazole, appropriate personal protective equipment (PPE) should b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...