Compound Q&A

What industries use 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6)?

Answer

2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate
2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) finds applications in various industries, including pharmaceuticals, where it is used as a precursor in the synthesis of drug molecules. It is also utilized in the polymer industry for modifying the properties of polymers and in the development of sensors and semiconductors due to its unique chemical structure.

About

English Name 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES CC(C)(C)OC(=O)N1CCNCC12CC2
InChIKey XNLYPHAMXHERHS-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6)?

2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) is a white crystallin...

Compound Q&A

How is 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) typically synthesized?

2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) can be synthesized th...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6)?

When handling 2-Methyl-2-proanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6), it is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...