Compound Q&A

How is 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) typically synthesized?

Answer

2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate
2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) can be synthesized through a multi-step process involving the condensation of 2-methyl-2-propanol with 4,7-diazaspiro[2.5]octane-4-carboxylic acid. The reaction typically proceeds with the use of a base such as sodium hydroxide and a catalytic amount of amines. The yield and selectivity can be enhanced with appropriate conditions and catalysts.

About

English Name 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES CC(C)(C)OC(=O)N1CCNCC12CC2
InChIKey XNLYPHAMXHERHS-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6)?

2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) is a white crystallin...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6)?

2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) finds applications in...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6)?

When handling 2-Methyl-2-proanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6), it is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...