Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6)?

Answer

2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate
2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) is a white crystalline solid with a molecular weight of approximately 198.24 g/mol. It has a low water solubility and is slightly soluble in common organic solvents. This compound exhibits moderate reactivity, particularly in ester and amide chemistry. It is thermally stable but may decompose under strong acidic or basic conditions.

About

English Name 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES CC(C)(C)OC(=O)N1CCNCC12CC2
InChIKey XNLYPHAMXHERHS-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) typically synthesized?

2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) can be synthesized th...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6)?

2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6) finds applications in...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6)?

When handling 2-Methyl-2-proanyl 4,7-diazaspiro[2.5]octane-4-carboxylate (CAS: 674792-08-6), it is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...