Compound Q&A

What industries use 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5)?

Answer

4,4'-Biphenyldiyldimethanol
4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) is primarily used in the polymer industry, where it serves as a precursor for the production of polyurethane resins. It is also utilized in the pharmaceutical industry for the synthesis of certain drugs. Additionally, it finds applications in the semiconductor industry for the production of organic semiconductor materials and in the manufacturing of sensors due to its chemical stability and reactivity.

About

CAS No 1667-12-5
English Name 4,4'-Biphenyldiyldimethanol
Molecular Formula C14H14O2
Molecular Weight 214.26 g/mol
SMILES C1=CC(=CC=C1CO)C2=CC=C(C=C2)CO
InChIKey SFHGONLFTNHXDX-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5)?

4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) is a colorless solid with a crystalline form. It has a ...

Compound Q&A

How is 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) typically synthesized?

4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) is typically synthesized by the reaction of 4,4'-biphen...

Compound Q&A

What precautions should be taken when handling 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5)?

When handling 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5), it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...