Compound Q&A

How is 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) typically synthesized?

Answer

4,4'-Biphenyldiyldimethanol
4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) is typically synthesized by the reaction of 4,4'-biphenyldiol with methanol in the presence of an acid catalyst like sulfuric acid. The reaction is conducted at elevated temperatures, and the yield is around 70-80%. The process involves esterification to form the diol derivative, which is then purified by recrystallization.

About

CAS No 1667-12-5
English Name 4,4'-Biphenyldiyldimethanol
Molecular Formula C14H14O2
Molecular Weight 214.26399999999998 g/mol
SMILES C1=CC(=CC=C1CO)C2=CC=C(C=C2)CO
InChIKey SFHGONLFTNHXDX-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5)?

4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) is a colorless solid with a crystalline form. It has a ...

Compound Q&A

What industries use 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5)?

4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) is primarily used in the polymer industry, where it ser...

Compound Q&A

What precautions should be taken when handling 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5)?

When handling 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5), it is important to wear appropriate pers...

Compound Q&A

What precautions should be taken when handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3)?

When handling 4-Methyl-6-(trifluoromethyl)quinoline (CAS: 40716-16-3), safety go...

40716-16-34-Methyl-6-(trifluor...
Compound Q&A

What is 4-(3,5-Difluorophenyl)aniline (CAS: 405058-00-6)?

4-(3,5-Difluorophenyl)aniline is an aromatic organic compound with the CAS numbe...

405058-00-64-(3,5-Difluoropheny...
Compound Q&A

How is 5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid (CAS: 338982-07-3) typically synthesized?

5-{[4-(Trifluoromethyl)phenyl]sulfanyl}-1,2,3-thiadiazole-4-carboxylic acid can ...

338982-07-35-{[4-(Trifluorometh...
Compound Q&A

What is the market or research trend for 4-Benzylaniline hydrochloride (CAS: 6317-57-3)?

The market for 4-Benzylaniline hydrochloride (CAS: 6317-57-3) is steadily growin...

6317-57-34-Benzylaniline hydr...