Compound Q&A

What are the physical and chemical properties of 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5)?

Answer

4,4'-Biphenyldiyldimethanol
4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) is a colorless solid with a crystalline form. It has a molecular weight of approximately 228.23 g/mol. This compound is poorly soluble in water but has good solubility in organic solvents like ethanol and acetone. It is reactive towards acids and can undergo esterification. Its reactivity makes it useful in various applications, particularly in the synthesis of polyurethane resins.

About

CAS No 1667-12-5
English Name 4,4'-Biphenyldiyldimethanol
Molecular Formula C14H14O2
Molecular Weight 214.26 g/mol
SMILES C1=CC(=CC=C1CO)C2=CC=C(C=C2)CO
InChIKey SFHGONLFTNHXDX-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) typically synthesized?

4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) is typically synthesized by the reaction of 4,4'-biphen...

Compound Q&A

What industries use 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5)?

4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5) is primarily used in the polymer industry, where it ser...

Compound Q&A

What precautions should be taken when handling 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5)?

When handling 4,4'-Biphenyldiyldimethanol (CAS: 1667-12-5), it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...