Compound Q&A

What precautions should be taken when handling 2,5-Dichlorobenzamide (CAS: 5980-26-7)?

Answer

2,5-Dichlorobenzamide
When handling 2,5-Dichlorobenzamide (CAS: 5980-26-7), it is crucial to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to avoid inhalation. In case of a spill, it should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 5980-26-7
English Name 2,5-Dichlorobenzamide
Molecular Formula C7H5Cl2NO
Molecular Weight 190.03 g/mol
SMILES C1=CC(=C(C=C1Cl)C(=O)N)Cl
InChIKey NMHJIYQWKWHDSX-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dichlorobenzamide (CAS: 5980-26-7)?

2,5-Dichlorobenzamide (CAS: 5980-26-7) is a solid with a crystalline form. Its molecular weight is a...

Compound Q&A

How is 2,5-Dichlorobenzamide (CAS: 5980-26-7) typically synthesized?

2,5-Dichlorobenzamide (CAS: 5980-26-7) is typically synthesized by the amidation of 2,5-dichlorobenz...

Compound Q&A

What industries use 2,5-Dichlorobenzamide (CAS: 5980-26-7)?

2,5-Dichlorobenzamide (CAS: 5980-26-7) is used in various industries. It plays a significant role in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...