Compound Q&A

What industries use 2,5-Dichlorobenzamide (CAS: 5980-26-7)?

Answer

2,5-Dichlorobenzamide
2,5-Dichlorobenzamide (CAS: 5980-26-7) is used in various industries. It plays a significant role in the pharmaceutical industry as an intermediate in the synthesis of drugs. It is also used in the polymer industry for the modification of polymers and in the sensor industry for the development of chemical sensors. Additionally, it has applications in the semiconductor industry for doping purposes.

About

CAS No 5980-26-7
English Name 2,5-Dichlorobenzamide
Molecular Formula C7H5Cl2NO
Molecular Weight 190.03 g/mol
SMILES C1=CC(=C(C=C1Cl)C(=O)N)Cl
InChIKey NMHJIYQWKWHDSX-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dichlorobenzamide (CAS: 5980-26-7)?

2,5-Dichlorobenzamide (CAS: 5980-26-7) is a solid with a crystalline form. Its molecular weight is a...

Compound Q&A

How is 2,5-Dichlorobenzamide (CAS: 5980-26-7) typically synthesized?

2,5-Dichlorobenzamide (CAS: 5980-26-7) is typically synthesized by the amidation of 2,5-dichlorobenz...

Compound Q&A

What precautions should be taken when handling 2,5-Dichlorobenzamide (CAS: 5980-26-7)?

When handling 2,5-Dichlorobenzamide (CAS: 5980-26-7), it is crucial to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...