Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2)?

Answer

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate
When handling 2-Methyl-2-proanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be done in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be handled with care, and the Material Safety Data Sheet (MSDS) should be referenced for specific cleanup procedures. Avoid contact with skin and eyes, and ensure proper disposal of waste materials.

About

English Name 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate
Molecular Formula C12H21NO3
Molecular Weight 227.3 g/mol
SMILES CC(=O)C1CCCN(C1)C(=O)OC(C)(C)C
InChIKey IIDISJMZFQAYKG-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2)?

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) is a crystalline compound wi...

Compound Q&A

How is 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) typically synthesized?

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) is typically synthesized via...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2)?

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) is primarily used in the pha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...