Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2)?

Answer

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate
2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) is a crystalline compound with a molecular weight of approximately 258.38 g/mol. It has a low water solubility and is soluble in organic solvents such as ethanol and acetone. It is relatively stable under normal conditions but can be reactive towards strong bases. It exhibits typical carboxylic acid properties and has a pKa of around 4.5.

About

English Name 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate
Molecular Formula C12H21NO3
Molecular Weight 227.3 g/mol
SMILES CC(=O)C1CCCN(C1)C(=O)OC(C)(C)C
InChIKey IIDISJMZFQAYKG-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) typically synthesized?

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) is typically synthesized via...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2)?

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2)?

When handling 2-Methyl-2-proanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2), it is crucial ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...