Compound Q&A

How is 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) typically synthesized?

Answer

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate
2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) is typically synthesized via a multistep process involving acetylation of 2-methyl-2-propanol followed by condensation with 1-piperidinecarboxylic acid. The synthesis requires careful control of reaction conditions, including temperature and catalyst selection, to achieve high yields and good selectivity. Commonly used catalysts include acetic anhydride and piperidine.

About

English Name 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate
Molecular Formula C12H21NO3
Molecular Weight 227.3 g/mol
SMILES CC(=O)C1CCCN(C1)C(=O)OC(C)(C)C
InChIKey IIDISJMZFQAYKG-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2)?

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) is a crystalline compound wi...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2)?

2-Methyl-2-propanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2) is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2)?

When handling 2-Methyl-2-proanyl 3-acetyl-1-piperidinecarboxylate (CAS: 858643-92-2), it is crucial ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...