Compound Q&A

What precautions should be taken when handling (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate (CAS: 74050-20-7)?

Answer

(11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate
When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and lab coats. It should be stored in a well-ventilated area, away from heat and sources of ignition. In case of a spill, use appropriate spill response materials, and consult the Safety Data Sheet (SDS) for detailed instructions.

About

CAS No 74050-20-7
English Name (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate
Molecular Formula C26H36O7
Molecular Weight 460.57 g/mol
SMILES CCC(=O)OC1(CCC2C1(CC(C3C2CCC4=CC(=O)CCC34C)O)C)C(=O)COC(=O)C
InChIKey MFBMYAOAMQLLPK-FZNHGJLXSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate (CAS: 74050-20-7)?

This compound is a crystalline solid with a molecular weight of approximately 412.44 g/mol. It has a...

Compound Q&A

How is (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate (CAS: 74050-20-7) typically synthesized?

This compound is typically synthesized through a series of reactions involving the acetylation of pr...

Compound Q&A

What industries use (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate (CAS: 74050-20-7)?

This compound is primarily used in the pharmaceutical industry, where it serves as an intermediate i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...