Compound Q&A

What industries use (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate (CAS: 74050-20-7)?

Answer

(11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate
This compound is primarily used in the pharmaceutical industry, where it serves as an intermediate in the synthesis of progestins and other steroid hormones. It has applications in research and development, particularly in the formulation of contraceptives and hormone replacement therapies.

About

CAS No 74050-20-7
English Name (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate
Molecular Formula C26H36O7
Molecular Weight 460.57 g/mol
SMILES CCC(=O)OC1(CCC2C1(CC(C3C2CCC4=CC(=O)CCC34C)O)C)C(=O)COC(=O)C
InChIKey MFBMYAOAMQLLPK-FZNHGJLXSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate (CAS: 74050-20-7)?

This compound is a crystalline solid with a molecular weight of approximately 412.44 g/mol. It has a...

Compound Q&A

How is (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate (CAS: 74050-20-7) typically synthesized?

This compound is typically synthesized through a series of reactions involving the acetylation of pr...

Compound Q&A

What precautions should be taken when handling (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate (CAS: 74050-20-7)?

When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...