Compound Q&A

What industries use (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride (CAS: 138124-32-0)?

Answer

(R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2- cyclohexanediaminomanganese(III) chloride
This compound is used in the pharmaceutical industry for its antioxidant and anti-inflammatory properties. It is also utilized in the polymer industry to enhance thermal stability and in the production of advanced materials. Additionally, it has applications in sensors for detecting specific chemical species.

About

English Name (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2- cyclohexanediaminomanganese(III) chloride
Molecular Formula C36H52ClMnN2O2
Molecular Weight 635.2 g/mol
SMILES CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)[O-])C=NC2CCCCC2N=CC3=C(C(=CC(=C3)C(C)(C)C)C(C)(C)C)[O-].[Cl-].[Mn+3]
InChIKey LJVAWOSDJSQANR-SEILFYAJSA-K
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride (CAS: 138124-32-0)?

The compound is a crystalline solid with a high molecular weight. It has limited solubility in water...

Compound Q&A

How is (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride (CAS: 138124-32-0) typically synthesized?

This compound is typically synthesized by reacting a mixture of 3,5-di-tertbutylsalicylaldehyde and ...

Compound Q&A

What precautions should be taken when handling (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride (CAS: 138124-32-0)?

Proper personal protective equipment (PPE) such as gloves and safety goggles should be worn. Handlin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...