Compound Q&A

How is (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride (CAS: 138124-32-0) typically synthesized?

Answer

(R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2- cyclohexanediaminomanganese(III) chloride
This compound is typically synthesized by reacting a mixture of 3,5-di-tertbutylsalicylaldehyde and 1,2-cyclohexanediamine with manganese(III) chloride in an appropriate solvent under controlled conditions. The reaction involves the formation of a complex through coordination of the ligands to manganese(III) ions.

About

English Name (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2- cyclohexanediaminomanganese(III) chloride
Molecular Formula C36H52ClMnN2O2
Molecular Weight 635.2 g/mol
SMILES CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)[O-])C=NC2CCCCC2N=CC3=C(C(=CC(=C3)C(C)(C)C)C(C)(C)C)[O-].[Cl-].[Mn+3]
InChIKey LJVAWOSDJSQANR-SEILFYAJSA-K
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride (CAS: 138124-32-0)?

The compound is a crystalline solid with a high molecular weight. It has limited solubility in water...

Compound Q&A

What industries use (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride (CAS: 138124-32-0)?

This compound is used in the pharmaceutical industry for its antioxidant and anti-inflammatory prope...

Compound Q&A

What precautions should be taken when handling (R,R)-(-)-N,N'-Bis(3,5-di-tertbutylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride (CAS: 138124-32-0)?

Proper personal protective equipment (PPE) such as gloves and safety goggles should be worn. Handlin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...