Compound Q&A

What industries use Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2)?

Answer

Diethyl 2-(2-oxopropyl)succinate
Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2) is used in various industries. It serves as a key intermediate in the production of pharmaceuticals, where it is utilized in the synthesis of active pharmaceutical ingredients. It also finds applications in polymer production, particularly in the synthesis of thermosetting resins, and in sensor technology and semiconductor manufacturing as a precursor for certain functional groups.

About

CAS No 1187-74-2
English Name Diethyl 2-(2-oxopropyl)succinate
Molecular Formula C11H18O5
Molecular Weight 230.26 g/mol
SMILES CCOC(=O)CC(CC(=O)C)C(=O)OCC
InChIKey AAPVOVKOHNCXJA-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2)?

Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2) is a colorless or slightly yellow crystalline comp...

Compound Q&A

How is Diethyl 2-(2-2-oxopropyl)succinate (CAS: 1187-74-2) typically synthesized?

Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2) can be synthesized via esterification of 2-(2-oxop...

Compound Q&A

What precautions should be taken when handling Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2)?

When handling Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2), it is crucial to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...