Compound Q&A

How is Diethyl 2-(2-2-oxopropyl)succinate (CAS: 1187-74-2) typically synthesized?

Answer

Diethyl 2-(2-oxopropyl)succinate
Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2) can be synthesized via esterification of 2-(2-oxopropyl)succinic acid with diethyl acetate. The reaction is typically catalyzed by strong acids such as concentrated sulfuric acid. The yield is generally high, and the product can be isolated by conventional techniques including recrystallization.

About

CAS No 1187-74-2
English Name Diethyl 2-(2-oxopropyl)succinate
Molecular Formula C11H18O5
Molecular Weight 230.26 g/mol
SMILES CCOC(=O)CC(CC(=O)C)C(=O)OCC
InChIKey AAPVOVKOHNCXJA-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2)?

Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2) is a colorless or slightly yellow crystalline comp...

Compound Q&A

What industries use Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2)?

Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2) is used in various industries. It serves as a key ...

Compound Q&A

What precautions should be taken when handling Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2)?

When handling Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2), it is crucial to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...