Compound Q&A

What are the physical and chemical properties of Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2)?

Answer

Diethyl 2-(2-oxopropyl)succinate
Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2) is a colorless or slightly yellow crystalline compound with a molecular weight of approximately 238.32 g/mol. It is sparingly soluble in water and soluble in common organic solvents like ethanol and acetone. It exhibits moderate reactivity, particularly in ester exchange reactions and esterification processes.

About

CAS No 1187-74-2
English Name Diethyl 2-(2-oxopropyl)succinate
Molecular Formula C11H18O5
Molecular Weight 230.26 g/mol
SMILES CCOC(=O)CC(CC(=O)C)C(=O)OCC
InChIKey AAPVOVKOHNCXJA-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Diethyl 2-(2-2-oxopropyl)succinate (CAS: 1187-74-2) typically synthesized?

Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2) can be synthesized via esterification of 2-(2-oxop...

Compound Q&A

What industries use Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2)?

Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2) is used in various industries. It serves as a key ...

Compound Q&A

What precautions should be taken when handling Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2)?

When handling Diethyl 2-(2-oxopropyl)succinate (CAS: 1187-74-2), it is crucial to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...