Compound Q&A

What industries use (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one (CAS: 668467-91-2)?

Answer

(3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one
This compound is primarily used in pharmaceuticals for its anti-inflammatory and analgesic properties. It is also utilized in the production of certain dyes and pigments due to its chromophoric nature. Additionally, it has potential applications in the development of new sensors and as a precursor in the synthesis of other complex molecules.

About

English Name (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one
Molecular Formula C17H11Cl3N2O3
Molecular Weight 397.65 g/mol
SMILES CC(=O)ON=C1C2=C(C=CC(=C2)Cl)N(C1=O)CC3=C(C=CC(=C3)Cl)Cl
InChIKey OPQRFPHLZZPCCH-PGMHBOJBSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one (CAS: 668467-91-2)?

The compound (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one has a ...

Compound Q&A

How is (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one (CAS: 668467-91-2) typically synthesized?

The compound is typically synthesized via a multi-step reaction involving acetoxyimino dehydratase, ...

Compound Q&A

What precautions should be taken when handling (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one (CAS: 668467-91-2)?

When handling (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one, it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...