Compound Q&A

What are the physical and chemical properties of (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one (CAS: 668467-91-2)?

Answer

(3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one
The compound (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one has a crystalline form and a molecular weight of approximately 472.97 g/mol. It is slightly soluble in organic solvents like ethanol and chloroform. Chemically, the compound is known for its reactivity towards nucleophiles and its stability in acidic conditions. It is not reactive towards bases or reducing agents under normal conditions.

About

English Name (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one
Molecular Formula C17H11Cl3N2O3
Molecular Weight 397.65 g/mol
SMILES CC(=O)ON=C1C2=C(C=CC(=C2)Cl)N(C1=O)CC3=C(C=CC(=C3)Cl)Cl
InChIKey OPQRFPHLZZPCCH-PGMHBOJBSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one (CAS: 668467-91-2) typically synthesized?

The compound is typically synthesized via a multi-step reaction involving acetoxyimino dehydratase, ...

Compound Q&A

What industries use (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one (CAS: 668467-91-2)?

This compound is primarily used in pharmaceuticals for its anti-inflammatory and analgesic propertie...

Compound Q&A

What precautions should be taken when handling (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one (CAS: 668467-91-2)?

When handling (3Z)-3-(Acetoxyimino)-5-chloro-1-(2,5-dichlorobenzyl)-1,3-dihydro-2H-indol-2-one, it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...