Compound Q&A

What industries use 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0)?

Answer

1,3-Dicyclohexyl-1H-imidazol-3-ium chloride
1,3-Dicyclohexyl-1H-imidazol-3-ium chloride is used in the pharmaceutical industry as a reagent for the synthesis of bioactive compounds. It also finds applications in the polymer and semiconductor industries, where its properties contribute to the development of advanced materials. Additionally, it is used in sensor technologies due to its reactivity and stability.

About

English Name 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride
Molecular Formula C15H25ClN2
Molecular Weight 268.82 g/mol
SMILES C1CCC(CC1)N2C=C[N+](=C2)C3CCCCC3.[Cl-]
InChIKey UPJKDKOHHMKJAY-UHFFFAOYSA-M
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0)?

1,3-Dicyclohexyl-1H-imidazol-3-ium chloride is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0) typically synthesized?

1,3-Dicyclohexyl-1H-imidazol-3-ium chloride is typically synthesized through the reaction of 1,3-dic...

Compound Q&A

What precautions should be taken when handling 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0)?

When handling 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride, it is important to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...