Compound Q&A

How is 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0) typically synthesized?

Answer

1,3-Dicyclohexyl-1H-imidazol-3-ium chloride
1,3-Dicyclohexyl-1H-imidazol-3-ium chloride is typically synthesized through the reaction of 1,3-dicyclohexylimidazole with hydrochloric acid. The reaction is carried out under mild conditions, and the product is isolated by recrystallization from suitable solvents. The process is selective and yields a high purity product.

About

English Name 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride
Molecular Formula C15H25ClN2
Molecular Weight 268.82 g/mol
SMILES C1CCC(CC1)N2C=C[N+](=C2)C3CCCCC3.[Cl-]
InChIKey UPJKDKOHHMKJAY-UHFFFAOYSA-M
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0)?

1,3-Dicyclohexyl-1H-imidazol-3-ium chloride is a white crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0)?

1,3-Dicyclohexyl-1H-imidazol-3-ium chloride is used in the pharmaceutical industry as a reagent for ...

Compound Q&A

What precautions should be taken when handling 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0)?

When handling 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride, it is important to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...