Compound Q&A

What are the physical and chemical properties of 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0)?

Answer

1,3-Dicyclohexyl-1H-imidazol-3-ium chloride
1,3-Dicyclohexyl-1H-imidazol-3-ium chloride is a white crystalline solid with a molecular weight of approximately 280.45 g/mol. It is sparingly soluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable under normal conditions but can react with strong acids or bases. It is not flammable and does not pose significant health risks under normal handling conditions.

About

English Name 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride
Molecular Formula C15H25ClN2
Molecular Weight 268.82 g/mol
SMILES C1CCC(CC1)N2C=C[N+](=C2)C3CCCCC3.[Cl-]
InChIKey UPJKDKOHHMKJAY-UHFFFAOYSA-M
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0) typically synthesized?

1,3-Dicyclohexyl-1H-imidazol-3-ium chloride is typically synthesized through the reaction of 1,3-dic...

Compound Q&A

What industries use 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0)?

1,3-Dicyclohexyl-1H-imidazol-3-ium chloride is used in the pharmaceutical industry as a reagent for ...

Compound Q&A

What precautions should be taken when handling 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride (CAS: 181422-72-0)?

When handling 1,3-Dicyclohexyl-1H-imidazol-3-ium chloride, it is important to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...