Compound Q&A

What industries use Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7)?

Answer

Methyl 4-(chlorosulfonyl)benzoate
Methyl 4-(chlorosulfonyl)benzoate is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of complex organic molecules. It is also used in polymer synthesis, particularly in the development of novel materials, and in the production of electronic sensors and semiconductors. Its reactivity makes it valuable in these applications.

About

CAS No 69812-51-7
English Name Methyl 4-(chlorosulfonyl)benzoate
Molecular Formula C8H7ClO4S
Molecular Weight 234.66 g/mol
SMILES COC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl
InChIKey MOFQDKOKODUZPK-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7)?

Methyl 4-(chlorosulfonyl)benzoate is a crystalline white solid with a molecular weight of approximat...

Compound Q&A

How is Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7) typically synthesized?

Methyl 4-(chlorosulfonyl)benzoate is typically synthesized by the reaction of benzoyl chloride with ...

Compound Q&A

What precautions should be taken when handling Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7)?

When handling Methyl 4-(chlorosulfonyl)benzoate, it is essential to use personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...