Compound Q&A

How is Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7) typically synthesized?

Answer

Methyl 4-(chlorosulfonyl)benzoate
Methyl 4-(chlorosulfonyl)benzoate is typically synthesized by the reaction of benzoyl chloride with sodium methoxide in a polar aprotic solvent like tetrahydrofuran (THF). The process involves the formation of a methoxy derivative followed by methanolysis, yielding the desired product. The reaction is selective and provides a good yield under mild conditions.

About

CAS No 69812-51-7
English Name Methyl 4-(chlorosulfonyl)benzoate
Molecular Formula C8H7ClO4S
Molecular Weight 234.66 g/mol
SMILES COC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl
InChIKey MOFQDKOKODUZPK-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7)?

Methyl 4-(chlorosulfonyl)benzoate is a crystalline white solid with a molecular weight of approximat...

Compound Q&A

What industries use Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7)?

Methyl 4-(chlorosulfonyl)benzoate is used in various industries, including pharmaceuticals, where it...

Compound Q&A

What precautions should be taken when handling Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7)?

When handling Methyl 4-(chlorosulfonyl)benzoate, it is essential to use personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...