Compound Q&A

What are the physical and chemical properties of Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7)?

Answer

Methyl 4-(chlorosulfonyl)benzoate
Methyl 4-(chlorosulfonyl)benzoate is a crystalline white solid with a molecular weight of approximately 261.04 g/mol. It has a high solubility in common organic solvents like dichloromethane and acetonitrile. This compound is highly reactive, particularly towards nucleophiles, making it useful in synthetic chemistry. It is insoluble in water and has a pKa of about 2.5.

About

CAS No 69812-51-7
English Name Methyl 4-(chlorosulfonyl)benzoate
Molecular Formula C8H7ClO4S
Molecular Weight 234.66 g/mol
SMILES COC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl
InChIKey MOFQDKOKODUZPK-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7) typically synthesized?

Methyl 4-(chlorosulfonyl)benzoate is typically synthesized by the reaction of benzoyl chloride with ...

Compound Q&A

What industries use Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7)?

Methyl 4-(chlorosulfonyl)benzoate is used in various industries, including pharmaceuticals, where it...

Compound Q&A

What precautions should be taken when handling Methyl 4-(chlorosulfonyl)benzoate (CAS: 69812-51-7)?

When handling Methyl 4-(chlorosulfonyl)benzoate, it is essential to use personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...