Compound Q&A

What industries use 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5)?

Answer

2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid
2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various pharmaceutical compounds and as a building block in polymer chemistry. Its use in sensor technology and semiconductor manufacturing is also being explored due to its functional groups.

About

CAS No 68790-38-5
English Name 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid
Molecular Formula C12H15NO4
Molecular Weight 237.26 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=CC=C1C(=O)O
InChIKey BYGHHEDJDSLEKK-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5)?

2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) is a crystalline solid w...

Compound Q&A

How is 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) typically synthesized?

2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) can be synthesized via d...

Compound Q&A

What precautions should be taken when handling 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5)?

When handling 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5), it is ess...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...