Compound Q&A

What are the physical and chemical properties of 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5)?

Answer

2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid
2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) is a crystalline solid with a molecular weight of approximately 298.33 g/mol. It has a low water solubility and is reactive towards bases, forming the corresponding sodium salt. It exhibits acidity due to its carboxylic acid group. This compound is stable under normal conditions but should be stored in a cool, dark place to prevent degradation.

About

CAS No 68790-38-5
English Name 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid
Molecular Formula C12H15NO4
Molecular Weight 237.26 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=CC=C1C(=O)O
InChIKey BYGHHEDJDSLEKK-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) typically synthesized?

2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) can be synthesized via d...

Compound Q&A

What industries use 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5)?

2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) is primarily used in the...

Compound Q&A

What precautions should be taken when handling 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5)?

When handling 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5), it is ess...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...