Compound Q&A

How is 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) typically synthesized?

Answer

2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid
2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) can be synthesized via direct condensation of 2-methyl-2-propanol with 2-amino-3-carboxybenzoyl chloride. This method involves the generation of an acyl chloride from the carboxylic acid, followed by an intramolecular esterification reaction. The reaction is typically performed under anhydrous conditions and at room temperature.

About

CAS No 68790-38-5
English Name 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid
Molecular Formula C12H15NO4
Molecular Weight 237.26 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=CC=C1C(=O)O
InChIKey BYGHHEDJDSLEKK-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5)?

2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) is a crystalline solid w...

Compound Q&A

What industries use 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5)?

2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5) is primarily used in the...

Compound Q&A

What precautions should be taken when handling 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5)?

When handling 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid (CAS: 68790-38-5), it is ess...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...