Compound Q&A

What industries use p-(Trifluoromethoxy)benzenesulphonyl chloride (CAS: 94108-56-2)?

Answer

p-(Trifluoromethoxy)benzenesulphonyl chloride
p-(Trifluoromethoxy)benzenesulphonyl chloride is primarily used in the pharmaceutical industry for the synthesis of drug intermediates and in the polymer industry for the production of specialized polymers. It is also utilized in the sensors and semiconductor industries for the development of advanced materials.

About

CAS No 94108-56-2
English Name p-(Trifluoromethoxy)benzenesulphonyl chloride
Molecular Formula C7H4ClF3O3S
Molecular Weight 260.62 g/mol
SMILES C1=CC(=CC=C1OC(F)(F)F)S(=O)(=O)Cl
InChIKey UHCDBMIOLNKDHG-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of p-(Trifluoromethoxy)benzenesulphonyl chloride (CAS: 94108-56-2)?

p-(Trifluoromethoxy)benzenesulphonyl chloride is a white crystalline solid with a molecular weight o...

Compound Q&A

How is p-(Trifluoromethoxy)benzenesulphonyl chloride (CAS: 94108-56-2) typically synthesized?

p-(Trifluoromethoxy)benzenesulphonyl chloride can be synthesized by the reaction of p-(trifluorometh...

Compound Q&A

What precautions should be taken when handling p-(Trifluoromethoxy)benzenesulphonyl chloride (CAS: 94108-56-2)?

Proper personal protective equipment (PPE) is essential when handling p-(Trifluoromethoxy)benzenesul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...