Compound Q&A

How is p-(Trifluoromethoxy)benzenesulphonyl chloride (CAS: 94108-56-2) typically synthesized?

Answer

p-(Trifluoromethoxy)benzenesulphonyl chloride
p-(Trifluoromethoxy)benzenesulphonyl chloride can be synthesized by the reaction of p-(trifluoromethoxy)benzene with thionyl chloride. This process typically involves the use of a catalyst to improve yield and selectivity. The reaction is carried out under anhydrous conditions to prevent hydrolysis and typically requires a fume hood for safety.

About

CAS No 94108-56-2
English Name p-(Trifluoromethoxy)benzenesulphonyl chloride
Molecular Formula C7H4ClF3O3S
Molecular Weight 260.62 g/mol
SMILES C1=CC(=CC=C1OC(F)(F)F)S(=O)(=O)Cl
InChIKey UHCDBMIOLNKDHG-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of p-(Trifluoromethoxy)benzenesulphonyl chloride (CAS: 94108-56-2)?

p-(Trifluoromethoxy)benzenesulphonyl chloride is a white crystalline solid with a molecular weight o...

Compound Q&A

What industries use p-(Trifluoromethoxy)benzenesulphonyl chloride (CAS: 94108-56-2)?

p-(Trifluoromethoxy)benzenesulphonyl chloride is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling p-(Trifluoromethoxy)benzenesulphonyl chloride (CAS: 94108-56-2)?

Proper personal protective equipment (PPE) is essential when handling p-(Trifluoromethoxy)benzenesul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...