Compound Q&A

What industries use 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7)?

Answer

2-Bromo-4-methyl-6-nitroaniline
2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7) is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It also finds applications in the production of dyes, pigments, and as an intermediate in the development of organic sensors and semiconductors.

About

CAS No 827-24-7
English Name 2-Bromo-4-methyl-6-nitroaniline
Molecular Formula C7H7BrN2O2
Molecular Weight 231.05 g/mol
SMILES Cc1cc(Br)c(N)c(c1)[N+](=O)[O-]
InChIKey VFPKZASVVCBVMG-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7)?

2-Bromo-4-methyl-6-nitroaniline is a white crystalline solid with a molecular weight of 228.03 g/mol...

Compound Q&A

How is 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7) typically synthesized?

2-Bromo-4-methyl-6-nitroaniline is typically synthesized via a multi-step process involving nitratio...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7)?

When handling 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7), it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...