Compound Q&A

What are the physical and chemical properties of 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7)?

Answer

2-Bromo-4-methyl-6-nitroaniline
2-Bromo-4-methyl-6-nitroaniline is a white crystalline solid with a molecular weight of 228.03 g/mol. It is slightly soluble in water but has good solubility in organic solvents like ethanol and acetone. The compound is known for its reactivity towards nucleophiles, making it useful in various synthetic transformations. It is stable under normal conditions but should be stored away from moisture and heat.

About

CAS No 827-24-7
English Name 2-Bromo-4-methyl-6-nitroaniline
Molecular Formula C7H7BrN2O2
Molecular Weight 231.05 g/mol
SMILES Cc1cc(Br)c(N)c(c1)[N+](=O)[O-]
InChIKey VFPKZASVVCBVMG-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7) typically synthesized?

2-Bromo-4-methyl-6-nitroaniline is typically synthesized via a multi-step process involving nitratio...

Compound Q&A

What industries use 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7)?

2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7) is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7)?

When handling 2-Bromo-4-methyl-6-nitroaniline (CAS: 827-24-7), it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...