Compound Q&A

What precautions should be taken when handling Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1)?

Answer

Pentadecafluorooctanoic acid ammoniate (1:1)
When handling Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1), wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure the work is conducted in a fume hood to minimize inhalation risks. Follow standard safety protocols and keep the material away from heat sources. Refer to the safety data sheet (SDS) for detailed handling information.

About

CAS No 3825-26-1
English Name Pentadecafluorooctanoic acid ammoniate (1:1)
Molecular Formula C8H4F15NO2
Molecular Weight 431.09 g/mol
SMILES C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[NH4+]
InChIKey YOALFLHFSFEMLP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1)?

Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) is a white crystalline solid with a hi...

Compound Q&A

How is Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) typically synthesized?

Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) is typically synthesized through the r...

Compound Q&A

What industries use Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1)?

Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) finds applications in the pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...